About 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline
4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline (PubChem CID 160968511) has the molecular formula C17H10Br2F6N2
and a molecular weight of 516.08 g/mol. Its IUPAC name is 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline |
| PubChem CID | 160968511 |
| Molecular Formula | C17H10Br2F6N2 |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 513.91 |
| IUPAC Name | 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1cc(Br)cc2cccnc12.Nc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C10H5BrF3N.C7H5BrF3N/c11-7-4-6-2-1-3-15-9(6)8(5-7)10(12,13)14;8-4-1-2-6(12)5(3-4)7(9,10)11/h1-5H;1-3H,12H2 |
| InChIKey | SXYCOFYFGUZAGA-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline?
The IUPAC name of 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline (CID 160968511) is 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline.
What is the SMILES notation for 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline?
The canonical SMILES for 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline is FC(F)(F)c1cc(Br)cc2cccnc12.Nc1ccc(Br)cc1C(F)(F)F.
What is the InChIKey of 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline?
The InChIKey is SXYCOFYFGUZAGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrF3N.C7H5BrF3N/c11-7-4-6-2-1-3-15-9(6)8(5-7)10(12,13)14;8-4-1-2-6(12)5(3-4)7(9,10)11/h1-5H;1-3H,12H2.
What are the key properties of 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline?
4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline has a molecular weight of 516.08 g/mol, XLogP of 7.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(trifluoromethyl)aniline;6-bromo-8-(trifluoromethyl)quinoline is sourced from PubChem (CID 160968511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).