About (4-chlorophenyl) morpholine-4-sulfonate
(4-chlorophenyl) morpholine-4-sulfonate (PubChem CID 3680578) has the molecular formula C10H12ClNO4S
and a molecular weight of 277.73 g/mol. Its IUPAC name is (4-chlorophenyl) morpholine-4-sulfonate.
Molecular Properties
| Compound Name | (4-chlorophenyl) morpholine-4-sulfonate |
| PubChem CID | 3680578 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | (4-chlorophenyl) morpholine-4-sulfonate |
| SMILES | O=S(=O)(Oc1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C10H12ClNO4S/c11-9-1-3-10(4-2-9)16-17(13,14)12-5-7-15-8-6-12/h1-4H,5-8H2 |
| InChIKey | BQZCQBJXMQBAEY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-chlorophenyl) morpholine-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) morpholine-4-sulfonate?
The IUPAC name of (4-chlorophenyl) morpholine-4-sulfonate (CID 3680578) is (4-chlorophenyl) morpholine-4-sulfonate.
What is the SMILES notation for (4-chlorophenyl) morpholine-4-sulfonate?
The canonical SMILES for (4-chlorophenyl) morpholine-4-sulfonate is O=S(=O)(Oc1ccc(Cl)cc1)N1CCOCC1.
What is the InChIKey of (4-chlorophenyl) morpholine-4-sulfonate?
The InChIKey is BQZCQBJXMQBAEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO4S/c11-9-1-3-10(4-2-9)16-17(13,14)12-5-7-15-8-6-12/h1-4H,5-8H2.
What are the key properties of (4-chlorophenyl) morpholine-4-sulfonate?
(4-chlorophenyl) morpholine-4-sulfonate has a molecular weight of 277.73 g/mol, XLogP of 1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) morpholine-4-sulfonate is sourced from PubChem (CID 3680578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).