About (5,7-dichloroquinolin-8-yl) benzenesulfonate
(5,7-dichloroquinolin-8-yl) benzenesulfonate (PubChem CID 2279090) has the molecular formula C15H9Cl2NO3S
and a molecular weight of 354.21 g/mol. Its IUPAC name is (5,7-dichloroquinolin-8-yl) benzenesulfonate.
Molecular Properties
| Compound Name | (5,7-dichloroquinolin-8-yl) benzenesulfonate |
| PubChem CID | 2279090 |
| Molecular Formula | C15H9Cl2NO3S |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | (5,7-dichloroquinolin-8-yl) benzenesulfonate |
| SMILES | O=S(=O)(Oc1c(Cl)cc(Cl)c2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C15H9Cl2NO3S/c16-12-9-13(17)15(14-11(12)7-4-8-18-14)21-22(19,20)10-5-2-1-3-6-10/h1-9H |
| InChIKey | NWXUDPLHLOQDKE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5,7-dichloroquinolin-8-yl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dichloroquinolin-8-yl) benzenesulfonate?
The IUPAC name of (5,7-dichloroquinolin-8-yl) benzenesulfonate (CID 2279090) is (5,7-dichloroquinolin-8-yl) benzenesulfonate.
What is the SMILES notation for (5,7-dichloroquinolin-8-yl) benzenesulfonate?
The canonical SMILES for (5,7-dichloroquinolin-8-yl) benzenesulfonate is O=S(=O)(Oc1c(Cl)cc(Cl)c2cccnc12)c1ccccc1.
What is the InChIKey of (5,7-dichloroquinolin-8-yl) benzenesulfonate?
The InChIKey is NWXUDPLHLOQDKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2NO3S/c16-12-9-13(17)15(14-11(12)7-4-8-18-14)21-22(19,20)10-5-2-1-3-6-10/h1-9H.
What are the key properties of (5,7-dichloroquinolin-8-yl) benzenesulfonate?
(5,7-dichloroquinolin-8-yl) benzenesulfonate has a molecular weight of 354.21 g/mol, XLogP of 4.31, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dichloroquinolin-8-yl) benzenesulfonate is sourced from PubChem (CID 2279090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).