C15H9Cl2NO3S — CID 2279090
(5,7-dichloroquinolin-8-yl) benzenesulfonate (PubChem CID 2279090) has the molecular formula C15H9Cl2NO3S and a molecular weight of 354.21 g/mol. Its IUPAC name is (5,7-dichloroquinolin-8-yl) benzenesulfonate.
| Compound Name | (5,7-dichloroquinolin-8-yl) benzenesulfonate |
|---|---|
| PubChem CID | 2279090 |
| Molecular Formula | C15H9Cl2NO3S |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | (5,7-dichloroquinolin-8-yl) benzenesulfonate |
| SMILES | O=S(=O)(Oc1c(Cl)cc(Cl)c2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C15H9Cl2NO3S/c16-12-9-13(17)15(14-11(12)7-4-8-18-14)21-22(19,20)10-5-2-1-3-6-10/h1-9H |
| InChIKey | NWXUDPLHLOQDKE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|