C19H17Cl2NO3S — CID 21210320
(5,7-dichloroquinolin-8-yl) 2-methyl-5-propan-2-ylbenzenesulfonate (PubChem CID 21210320) has the molecular formula C19H17Cl2NO3S and a molecular weight of 410.32 g/mol. Its IUPAC name is (5,7-dichloroquinolin-8-yl) 2-methyl-5-propan-2-ylbenzenesulfonate.
| Compound Name | (5,7-dichloroquinolin-8-yl) 2-methyl-5-propan-2-ylbenzenesulfonate |
|---|---|
| PubChem CID | 21210320 |
| Molecular Formula | C19H17Cl2NO3S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | (5,7-dichloroquinolin-8-yl) 2-methyl-5-propan-2-ylbenzenesulfonate |
| SMILES | Cc1ccc(C(C)C)cc1S(=O)(=O)Oc1c(Cl)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C19H17Cl2NO3S/c1-11(2)13-7-6-12(3)17(9-13)26(23,24)25-19-16(21)10-15(20)14-5-4-8-22-18(14)19/h4-11H,1-3H3 |
| InChIKey | OQNGHMUQFRVISK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|