About (3-methoxyphenyl) 8-methylquinoline-5-sulfonate
(3-methoxyphenyl) 8-methylquinoline-5-sulfonate (PubChem CID 46556074) has the molecular formula C17H15NO4S
and a molecular weight of 329.38 g/mol. Its IUPAC name is (3-methoxyphenyl) 8-methylquinoline-5-sulfonate.
Molecular Properties
| Compound Name | (3-methoxyphenyl) 8-methylquinoline-5-sulfonate |
| PubChem CID | 46556074 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (3-methoxyphenyl) 8-methylquinoline-5-sulfonate |
| SMILES | COc1cccc(OS(=O)(=O)c2ccc(C)c3ncccc23)c1 |
| InChI | InChI=1S/C17H15NO4S/c1-12-8-9-16(15-7-4-10-18-17(12)15)23(19,20)22-14-6-3-5-13(11-14)21-2/h3-11H,1-2H3 |
| InChIKey | YZZQMXPIYRPYNZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxyphenyl) 8-methylquinoline-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl) 8-methylquinoline-5-sulfonate?
The IUPAC name of (3-methoxyphenyl) 8-methylquinoline-5-sulfonate (CID 46556074) is (3-methoxyphenyl) 8-methylquinoline-5-sulfonate.
What is the SMILES notation for (3-methoxyphenyl) 8-methylquinoline-5-sulfonate?
The canonical SMILES for (3-methoxyphenyl) 8-methylquinoline-5-sulfonate is COc1cccc(OS(=O)(=O)c2ccc(C)c3ncccc23)c1.
What is the InChIKey of (3-methoxyphenyl) 8-methylquinoline-5-sulfonate?
The InChIKey is YZZQMXPIYRPYNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4S/c1-12-8-9-16(15-7-4-10-18-17(12)15)23(19,20)22-14-6-3-5-13(11-14)21-2/h3-11H,1-2H3.
What are the key properties of (3-methoxyphenyl) 8-methylquinoline-5-sulfonate?
(3-methoxyphenyl) 8-methylquinoline-5-sulfonate has a molecular weight of 329.38 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl) 8-methylquinoline-5-sulfonate is sourced from PubChem (CID 46556074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).