C17H12BrCl2NO3S — CID 21210191
(5,7-dichloroquinolin-8-yl) 4-bromo-2,5-dimethylbenzenesulfonate (PubChem CID 21210191) has the molecular formula C17H12BrCl2NO3S and a molecular weight of 461.16 g/mol. Its IUPAC name is (5,7-dichloroquinolin-8-yl) 4-bromo-2,5-dimethylbenzenesulfonate.
| Compound Name | (5,7-dichloroquinolin-8-yl) 4-bromo-2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 21210191 |
| Molecular Formula | C17H12BrCl2NO3S |
| Molecular Weight | 461.16 g/mol |
| Exact Mass | 458.91 |
| IUPAC Name | (5,7-dichloroquinolin-8-yl) 4-bromo-2,5-dimethylbenzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)Oc2c(Cl)cc(Cl)c3cccnc23)c(C)cc1Br |
| InChI | InChI=1S/C17H12BrCl2NO3S/c1-9-7-15(10(2)6-12(9)18)25(22,23)24-17-14(20)8-13(19)11-4-3-5-21-16(11)17/h3-8H,1-2H3 |
| InChIKey | COKKXNUMWXRAIK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.16 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|