C16H8BrCl2NO2 — CID 4196759
(5,7-dichloroquinolin-8-yl) 2-bromobenzoate (PubChem CID 4196759) has the molecular formula C16H8BrCl2NO2 and a molecular weight of 397.06 g/mol. Its IUPAC name is (5,7-dichloroquinolin-8-yl) 2-bromobenzoate.
| Compound Name | (5,7-dichloroquinolin-8-yl) 2-bromobenzoate |
|---|---|
| PubChem CID | 4196759 |
| Molecular Formula | C16H8BrCl2NO2 |
| Molecular Weight | 397.06 g/mol |
| Exact Mass | 394.91 |
| IUPAC Name | (5,7-dichloroquinolin-8-yl) 2-bromobenzoate |
| SMILES | O=C(Oc1c(Cl)cc(Cl)c2cccnc12)c1ccccc1Br |
| InChI | InChI=1S/C16H8BrCl2NO2/c17-11-6-2-1-4-9(11)16(21)22-15-13(19)8-12(18)10-5-3-7-20-14(10)15/h1-8H |
| InChIKey | DOKAJIRCMIBNRB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.06 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|