C18H9Cl2F3O2 — CID 91726264
(2,4-dichloronaphthalen-1-yl) 2-(trifluoromethyl)benzoate (PubChem CID 91726264) has the molecular formula C18H9Cl2F3O2 and a molecular weight of 385.17 g/mol. Its IUPAC name is (2,4-dichloronaphthalen-1-yl) 2-(trifluoromethyl)benzoate.
| Compound Name | (2,4-dichloronaphthalen-1-yl) 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 91726264 |
| Molecular Formula | C18H9Cl2F3O2 |
| Molecular Weight | 385.17 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | (2,4-dichloronaphthalen-1-yl) 2-(trifluoromethyl)benzoate |
| SMILES | O=C(Oc1c(Cl)cc(Cl)c2ccccc12)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H9Cl2F3O2/c19-14-9-15(20)16(11-6-2-1-5-10(11)14)25-17(24)12-7-3-4-8-13(12)18(21,22)23/h1-9H |
| InChIKey | MHPPKASTYHXICB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.17 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|