C15H14Cl2O2 — CID 91734569
(2,4-dichloronaphthalen-1-yl) 2,2-dimethylpropanoate (PubChem CID 91734569) has the molecular formula C15H14Cl2O2 and a molecular weight of 297.18 g/mol. Its IUPAC name is (2,4-dichloronaphthalen-1-yl) 2,2-dimethylpropanoate.
| Compound Name | (2,4-dichloronaphthalen-1-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91734569 |
| Molecular Formula | C15H14Cl2O2 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (2,4-dichloronaphthalen-1-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1c(Cl)cc(Cl)c2ccccc12 |
| InChI | InChI=1S/C15H14Cl2O2/c1-15(2,3)14(18)19-13-10-7-5-4-6-9(10)11(16)8-12(13)17/h4-8H,1-3H3 |
| InChIKey | DVBIJBKGAYMOMH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|