C14H14ClNO2 — CID 142729394
(2-chloroquinolin-5-yl) 2,2-dimethylpropanoate (PubChem CID 142729394) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is (2-chloroquinolin-5-yl) 2,2-dimethylpropanoate.
| Compound Name | (2-chloroquinolin-5-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 142729394 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | (2-chloroquinolin-5-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cccc2nc(Cl)ccc12 |
| InChI | InChI=1S/C14H14ClNO2/c1-14(2,3)13(17)18-11-6-4-5-10-9(11)7-8-12(15)16-10/h4-8H,1-3H3 |
| InChIKey | QFUAMXQBLHGAIB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|