C20H24O4 — CID 89353926
tert-butyl 5-(2,2-dimethylpropanoyloxy)naphthalene-1-carboxylate (PubChem CID 89353926) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl 5-(2,2-dimethylpropanoyloxy)naphthalene-1-carboxylate.
| Compound Name | tert-butyl 5-(2,2-dimethylpropanoyloxy)naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 89353926 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | tert-butyl 5-(2,2-dimethylpropanoyloxy)naphthalene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cccc2c(OC(=O)C(C)(C)C)cccc12 |
| InChI | InChI=1S/C20H24O4/c1-19(2,3)18(22)23-16-12-8-9-13-14(16)10-7-11-15(13)17(21)24-20(4,5)6/h7-12H,1-6H3 |
| InChIKey | UKVFQPMRHLNEQF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|