About tert-butyl 1H-indole-4-carboxylate
tert-butyl 1H-indole-4-carboxylate (PubChem CID 11206721) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is tert-butyl 1H-indole-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1H-indole-4-carboxylate |
| PubChem CID | 11206721 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | tert-butyl 1H-indole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C13H15NO2/c1-13(2,3)16-12(15)10-5-4-6-11-9(10)7-8-14-11/h4-8,14H,1-3H3 |
| InChIKey | MMAGWAVWHXWHAC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 1H-indole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1H-indole-4-carboxylate?
The IUPAC name of tert-butyl 1H-indole-4-carboxylate (CID 11206721) is tert-butyl 1H-indole-4-carboxylate.
What is the SMILES notation for tert-butyl 1H-indole-4-carboxylate?
The canonical SMILES for tert-butyl 1H-indole-4-carboxylate is CC(C)(C)OC(=O)c1cccc2[nH]ccc12.
What is the InChIKey of tert-butyl 1H-indole-4-carboxylate?
The InChIKey is MMAGWAVWHXWHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-13(2,3)16-12(15)10-5-4-6-11-9(10)7-8-14-11/h4-8,14H,1-3H3.
What are the key properties of tert-butyl 1H-indole-4-carboxylate?
tert-butyl 1H-indole-4-carboxylate has a molecular weight of 217.27 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1H-indole-4-carboxylate is sourced from PubChem (CID 11206721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).