About 1H-indole-4-carbonyl bromide
1H-indole-4-carbonyl bromide (PubChem CID 175285982) has the molecular formula C9H6BrNO
and a molecular weight of 224.06 g/mol. Its IUPAC name is 1H-indole-4-carbonyl bromide.
Molecular Properties
| Compound Name | 1H-indole-4-carbonyl bromide |
| PubChem CID | 175285982 |
| Molecular Formula | C9H6BrNO |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 222.96 |
| IUPAC Name | 1H-indole-4-carbonyl bromide |
| SMILES | O=C(Br)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C9H6BrNO/c10-9(12)7-2-1-3-8-6(7)4-5-11-8/h1-5,11H |
| InChIKey | XRTRRSKMZOWNBN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-4-carbonyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-4-carbonyl bromide?
The IUPAC name of 1H-indole-4-carbonyl bromide (CID 175285982) is 1H-indole-4-carbonyl bromide.
What is the SMILES notation for 1H-indole-4-carbonyl bromide?
The canonical SMILES for 1H-indole-4-carbonyl bromide is O=C(Br)c1cccc2[nH]ccc12.
What is the InChIKey of 1H-indole-4-carbonyl bromide?
The InChIKey is XRTRRSKMZOWNBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrNO/c10-9(12)7-2-1-3-8-6(7)4-5-11-8/h1-5,11H.
What are the key properties of 1H-indole-4-carbonyl bromide?
1H-indole-4-carbonyl bromide has a molecular weight of 224.06 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-4-carbonyl bromide is sourced from PubChem (CID 175285982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).