C14H16N2O — CID 43582325
N-cyclopentyl-1H-indole-4-carboxamide (PubChem CID 43582325) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is N-cyclopentyl-1H-indole-4-carboxamide.
| Compound Name | N-cyclopentyl-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 43582325 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-cyclopentyl-1H-indole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C14H16N2O/c17-14(16-10-4-1-2-5-10)12-6-3-7-13-11(12)8-9-15-13/h3,6-10,15H,1-2,4-5H2,(H,16,17) |
| InChIKey | CHSXJDGUXIECTK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |