C19H18N2O — CID 20872294
N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-indole-4-carboxamide (PubChem CID 20872294) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-indole-4-carboxamide.
| Compound Name | N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 20872294 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-indole-4-carboxamide |
| SMILES | O=C(N[C@H]1CCc2ccccc2C1)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C19H18N2O/c22-19(17-6-3-7-18-16(17)10-11-20-18)21-15-9-8-13-4-1-2-5-14(13)12-15/h1-7,10-11,15,20H,8-9,12H2,(H,21,22)/t15-/m0/s1 |
| InChIKey | FHUKXYYOKSREHX-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |