C21H19N3O — CID 110207920
N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)-1H-indole-4-carboxamide (PubChem CID 110207920) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)-1H-indole-4-carboxamide.
| Compound Name | N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 110207920 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)-1H-indole-4-carboxamide |
| SMILES | O=C(NC1CCCc2c1[nH]c1ccccc21)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C21H19N3O/c25-21(16-7-4-9-17-14(16)11-12-22-17)24-19-10-3-6-15-13-5-1-2-8-18(13)23-20(15)19/h1-2,4-5,7-9,11-12,19,22-23H,3,6,10H2,(H,24,25) |
| InChIKey | YVFAIEOLAXLKIF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|