About N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide
N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 4375) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide.
Molecular Properties
| Compound Name | N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
| PubChem CID | 4375 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CNC(=O)c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C13H11N3O/c1-14-13(17)11-6-9-8-4-2-3-5-10(8)16-12(9)7-15-11/h2-7,16H,1H3,(H,14,17) |
| InChIKey | QMCOPDWHWYSJSA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide?
The IUPAC name of N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide (CID 4375) is N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide.
What is the SMILES notation for N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide?
The canonical SMILES for N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide is CNC(=O)c1cc2c(cn1)[nH]c1ccccc12.
What is the InChIKey of N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide?
The InChIKey is QMCOPDWHWYSJSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c1-14-13(17)11-6-9-8-4-2-3-5-10(8)16-12(9)7-15-11/h2-7,16H,1H3,(H,14,17).
What are the key properties of N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide?
N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide has a molecular weight of 225.25 g/mol, XLogP of 2.08, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide is sourced from PubChem (CID 4375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).