C20H18O10 — CID 54118881
2-[2-carboxy-6-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]peroxybenzene-1,3-dicarboxylic acid (PubChem CID 54118881) has the molecular formula C20H18O10 and a molecular weight of 418.35 g/mol. Its IUPAC name is 2-[2-carboxy-6-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]peroxybenzene-1,3-dicarboxylic acid.
| Compound Name | 2-[2-carboxy-6-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]peroxybenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 54118881 |
| Molecular Formula | C20H18O10 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-[2-carboxy-6-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]peroxybenzene-1,3-dicarboxylic acid |
| SMILES | CC(C)(C)OC(=O)c1cccc(C(=O)O)c1OOc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C20H18O10/c1-20(2,3)28-19(27)13-9-5-8-12(18(25)26)15(13)30-29-14-10(16(21)22)6-4-7-11(14)17(23)24/h4-9H,1-3H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | NMFRIPLLFUUMSH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|