C18H27BO6 — CID 101443525
ditert-butyl 2-dimethoxyboranylbenzene-1,3-dicarboxylate (PubChem CID 101443525) has the molecular formula C18H27BO6 and a molecular weight of 350.22 g/mol. Its IUPAC name is ditert-butyl 2-dimethoxyboranylbenzene-1,3-dicarboxylate.
| Compound Name | ditert-butyl 2-dimethoxyboranylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101443525 |
| Molecular Formula | C18H27BO6 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | ditert-butyl 2-dimethoxyboranylbenzene-1,3-dicarboxylate |
| SMILES | COB(OC)c1c(C(=O)OC(C)(C)C)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27BO6/c1-17(2,3)24-15(20)12-10-9-11-13(14(12)19(22-7)23-8)16(21)25-18(4,5)6/h9-11H,1-8H3 |
| InChIKey | CMMAAMWYEJDQCA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|