C14H10Cl2O4 — CID 91734446
(2,4-dichloronaphthalen-1-yl) 2-acetyloxyacetate (PubChem CID 91734446) has the molecular formula C14H10Cl2O4 and a molecular weight of 313.14 g/mol. Its IUPAC name is (2,4-dichloronaphthalen-1-yl) 2-acetyloxyacetate.
| Compound Name | (2,4-dichloronaphthalen-1-yl) 2-acetyloxyacetate |
|---|---|
| PubChem CID | 91734446 |
| Molecular Formula | C14H10Cl2O4 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | (2,4-dichloronaphthalen-1-yl) 2-acetyloxyacetate |
| SMILES | CC(=O)OCC(=O)Oc1c(Cl)cc(Cl)c2ccccc12 |
| InChI | InChI=1S/C14H10Cl2O4/c1-8(17)19-7-13(18)20-14-10-5-3-2-4-9(10)11(15)6-12(14)16/h2-6H,7H2,1H3 |
| InChIKey | UKADSAWSOBODHK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|