C13H12Cl2O — CID 70099872
2,4-dichloro-1-propoxynaphthalene (PubChem CID 70099872) has the molecular formula C13H12Cl2O and a molecular weight of 255.14 g/mol. Its IUPAC name is 2,4-dichloro-1-propoxynaphthalene.
| Compound Name | 2,4-dichloro-1-propoxynaphthalene |
|---|---|
| PubChem CID | 70099872 |
| Molecular Formula | C13H12Cl2O |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2,4-dichloro-1-propoxynaphthalene |
| SMILES | CCCOc1c(Cl)cc(Cl)c2ccccc12 |
| InChI | InChI=1S/C13H12Cl2O/c1-2-7-16-13-10-6-4-3-5-9(10)11(14)8-12(13)15/h3-6,8H,2,7H2,1H3 |
| InChIKey | FQZWPWYUJJIHKG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |