C9H10Cl2O2 — CID 82267104
3,5-dichloro-2-propoxyphenol (PubChem CID 82267104) has the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. Its IUPAC name is 3,5-dichloro-2-propoxyphenol.
| Compound Name | 3,5-dichloro-2-propoxyphenol |
|---|---|
| PubChem CID | 82267104 |
| Molecular Formula | C9H10Cl2O2 |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 3,5-dichloro-2-propoxyphenol |
| SMILES | CCCOc1c(O)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2O2/c1-2-3-13-9-7(11)4-6(10)5-8(9)12/h4-5,12H,2-3H2,1H3 |
| InChIKey | XMKNQYKJAISRCY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |