3-(3,5-dichloro-2-propoxyphenyl)propanoic acid

C12H14Cl2O3 — CID 82267091

IUPAC3-(3,5-dichloro-2-propoxyphenyl)propanoic acid
SMILESCCCOc1c(Cl)cc(Cl)cc1CCC(=O)O
InChIInChI=1S/C12H14Cl2O3/c1-2-5-17-12-8(3-4-11(15)16)6-9(13)7-10(12)14/h6-7H,2-5H2,1H3,(H,15,16)
InChIKeyZIIJUIYMGGJQKJ-UHFFFAOYSA-N
MW277.15 g/mol
LogP3.80
Rot. Bonds6

About 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid

3-(3,5-dichloro-2-propoxyphenyl)propanoic acid (PubChem CID 82267091) has the molecular formula C12H14Cl2O3 and a molecular weight of 277.15 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid.

Molecular Properties

Compound Name3-(3,5-dichloro-2-propoxyphenyl)propanoic acid
PubChem CID82267091
Molecular FormulaC12H14Cl2O3
Molecular Weight277.15 g/mol
Exact Mass276.03
IUPAC Name3-(3,5-dichloro-2-propoxyphenyl)propanoic acid
SMILESCCCOc1c(Cl)cc(Cl)cc1CCC(=O)O
InChIInChI=1S/C12H14Cl2O3/c1-2-5-17-12-8(3-4-11(15)16)6-9(13)7-10(12)14/h6-7H,2-5H2,1H3,(H,15,16)
InChIKeyZIIJUIYMGGJQKJ-UHFFFAOYSA-N
XLogP3.80
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.15
LogP ≤ 53.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid?
The IUPAC name of 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid (CID 82267091) is 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid.
What is the SMILES notation for 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid?
The canonical SMILES for 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid is CCCOc1c(Cl)cc(Cl)cc1CCC(=O)O.
What is the InChIKey of 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid?
The InChIKey is ZIIJUIYMGGJQKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2O3/c1-2-5-17-12-8(3-4-11(15)16)6-9(13)7-10(12)14/h6-7H,2-5H2,1H3,(H,15,16).
What are the key properties of 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid?
3-(3,5-dichloro-2-propoxyphenyl)propanoic acid has a molecular weight of 277.15 g/mol, XLogP of 3.80, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid is sourced from PubChem (CID 82267091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).