C12H14Cl2O3 — CID 82267091
3-(3,5-dichloro-2-propoxyphenyl)propanoic acid (PubChem CID 82267091) has the molecular formula C12H14Cl2O3 and a molecular weight of 277.15 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid.
| Compound Name | 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 82267091 |
| Molecular Formula | C12H14Cl2O3 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3-(3,5-dichloro-2-propoxyphenyl)propanoic acid |
| SMILES | CCCOc1c(Cl)cc(Cl)cc1CCC(=O)O |
| InChI | InChI=1S/C12H14Cl2O3/c1-2-5-17-12-8(3-4-11(15)16)6-9(13)7-10(12)14/h6-7H,2-5H2,1H3,(H,15,16) |
| InChIKey | ZIIJUIYMGGJQKJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |