C13H17Cl2NOS — CID 83941328
4-(3,5-dichloro-2-propoxyphenyl)butanethioamide (PubChem CID 83941328) has the molecular formula C13H17Cl2NOS and a molecular weight of 306.26 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-propoxyphenyl)butanethioamide.
| Compound Name | 4-(3,5-dichloro-2-propoxyphenyl)butanethioamide |
|---|---|
| PubChem CID | 83941328 |
| Molecular Formula | C13H17Cl2NOS |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 4-(3,5-dichloro-2-propoxyphenyl)butanethioamide |
| SMILES | CCCOc1c(Cl)cc(Cl)cc1CCCC(N)=S |
| InChI | InChI=1S/C13H17Cl2NOS/c1-2-6-17-13-9(4-3-5-12(16)18)7-10(14)8-11(13)15/h7-8H,2-6H2,1H3,(H2,16,18) |
| InChIKey | YXVZBTDVSSBJKZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|