C15H22Cl2N2O — CID 82267120
1-[2-(3,5-dichloro-2-propoxyphenyl)ethyl]piperazine (PubChem CID 82267120) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is 1-[2-(3,5-dichloro-2-propoxyphenyl)ethyl]piperazine.
| Compound Name | 1-[2-(3,5-dichloro-2-propoxyphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 82267120 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-[2-(3,5-dichloro-2-propoxyphenyl)ethyl]piperazine |
| SMILES | CCCOc1c(Cl)cc(Cl)cc1CCN1CCNCC1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-2-9-20-15-12(10-13(16)11-14(15)17)3-6-19-7-4-18-5-8-19/h10-11,18H,2-9H2,1H3 |
| InChIKey | VKBAWWQLHHYGJA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |