C15H23ClN2O2 — CID 117481369
1-[2-(5-chloro-3,4-dimethoxy-2-methylphenyl)ethyl]piperazine (PubChem CID 117481369) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 1-[2-(5-chloro-3,4-dimethoxy-2-methylphenyl)ethyl]piperazine.
| Compound Name | 1-[2-(5-chloro-3,4-dimethoxy-2-methylphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 117481369 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[2-(5-chloro-3,4-dimethoxy-2-methylphenyl)ethyl]piperazine |
| SMILES | COc1c(Cl)cc(CCN2CCNCC2)c(C)c1OC |
| InChI | InChI=1S/C15H23ClN2O2/c1-11-12(4-7-18-8-5-17-6-9-18)10-13(16)15(20-3)14(11)19-2/h10,17H,4-9H2,1-3H3 |
| InChIKey | NZTBHOOFLIIMKV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |