C16H25ClN2O2 — CID 117497936
1-[(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)methyl]piperazine (PubChem CID 117497936) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 1-[(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)methyl]piperazine.
| Compound Name | 1-[(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 117497936 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)methyl]piperazine |
| SMILES | COc1c(Cl)cc(CN2CCNCC2)c(C(C)C)c1OC |
| InChI | InChI=1S/C16H25ClN2O2/c1-11(2)14-12(10-19-7-5-18-6-8-19)9-13(17)15(20-3)16(14)21-4/h9,11,18H,5-8,10H2,1-4H3 |
| InChIKey | NRJWNKJELCYHNZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |