C14H21ClN2O2 — CID 117458589
1-[2-(5-chloro-2,3-dimethoxyphenyl)ethyl]piperazine (PubChem CID 117458589) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 1-[2-(5-chloro-2,3-dimethoxyphenyl)ethyl]piperazine.
| Compound Name | 1-[2-(5-chloro-2,3-dimethoxyphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 117458589 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-[2-(5-chloro-2,3-dimethoxyphenyl)ethyl]piperazine |
| SMILES | COc1cc(Cl)cc(CCN2CCNCC2)c1OC |
| InChI | InChI=1S/C14H21ClN2O2/c1-18-13-10-12(15)9-11(14(13)19-2)3-6-17-7-4-16-5-8-17/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | XBPSADNLCGTEDG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |