C16H24FNO2S — CID 83923221
4-(2-fluoro-4,5-dipropoxyphenyl)butanethioamide (PubChem CID 83923221) has the molecular formula C16H24FNO2S and a molecular weight of 313.44 g/mol. Its IUPAC name is 4-(2-fluoro-4,5-dipropoxyphenyl)butanethioamide.
| Compound Name | 4-(2-fluoro-4,5-dipropoxyphenyl)butanethioamide |
|---|---|
| PubChem CID | 83923221 |
| Molecular Formula | C16H24FNO2S |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-(2-fluoro-4,5-dipropoxyphenyl)butanethioamide |
| SMILES | CCCOc1cc(F)c(CCCC(N)=S)cc1OCCC |
| InChI | InChI=1S/C16H24FNO2S/c1-3-8-19-14-10-12(6-5-7-16(18)21)13(17)11-15(14)20-9-4-2/h10-11H,3-9H2,1-2H3,(H2,18,21) |
| InChIKey | SJDNHCRSUFNRDD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|