C18H27FO3 — CID 83923264
2-ethyl-3-[2-(2-fluoro-4,5-dipropoxyphenyl)ethyl]oxirane (PubChem CID 83923264) has the molecular formula C18H27FO3 and a molecular weight of 310.41 g/mol. Its IUPAC name is 2-ethyl-3-[2-(2-fluoro-4,5-dipropoxyphenyl)ethyl]oxirane.
| Compound Name | 2-ethyl-3-[2-(2-fluoro-4,5-dipropoxyphenyl)ethyl]oxirane |
|---|---|
| PubChem CID | 83923264 |
| Molecular Formula | C18H27FO3 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-ethyl-3-[2-(2-fluoro-4,5-dipropoxyphenyl)ethyl]oxirane |
| SMILES | CCCOc1cc(F)c(CCC2OC2CC)cc1OCCC |
| InChI | InChI=1S/C18H27FO3/c1-4-9-20-17-11-13(7-8-16-15(6-3)22-16)14(19)12-18(17)21-10-5-2/h11-12,15-16H,4-10H2,1-3H3 |
| InChIKey | PXJPZVXBMWDOBZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|