C13H19F2NO — CID 170890380
1-(4,5-difluoro-2-propoxyphenyl)butan-2-amine (PubChem CID 170890380) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 1-(4,5-difluoro-2-propoxyphenyl)butan-2-amine.
| Compound Name | 1-(4,5-difluoro-2-propoxyphenyl)butan-2-amine |
|---|---|
| PubChem CID | 170890380 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(4,5-difluoro-2-propoxyphenyl)butan-2-amine |
| SMILES | CCCOc1cc(F)c(F)cc1CC(N)CC |
| InChI | InChI=1S/C13H19F2NO/c1-3-5-17-13-8-12(15)11(14)7-9(13)6-10(16)4-2/h7-8,10H,3-6,16H2,1-2H3 |
| InChIKey | HKRXOUVXIXVWQR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |