C15H25NO2S — CID 176553691
1-(2,5-diethoxy-4-methylsulfanylphenyl)butan-2-amine (PubChem CID 176553691) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is 1-(2,5-diethoxy-4-methylsulfanylphenyl)butan-2-amine.
| Compound Name | 1-(2,5-diethoxy-4-methylsulfanylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 176553691 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-(2,5-diethoxy-4-methylsulfanylphenyl)butan-2-amine |
| SMILES | CCOc1cc(SC)c(OCC)cc1CC(N)CC |
| InChI | InChI=1S/C15H25NO2S/c1-5-12(16)8-11-9-14(18-7-3)15(19-4)10-13(11)17-6-2/h9-10,12H,5-8,16H2,1-4H3 |
| InChIKey | GFYJQBAJJDXZCX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |