C16H28ClNO — CID 170889656
1-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)butan-2-amine;hydrochloride (PubChem CID 170889656) has the molecular formula C16H28ClNO and a molecular weight of 285.86 g/mol. Its IUPAC name is 1-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)butan-2-amine;hydrochloride.
| Compound Name | 1-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889656 |
| Molecular Formula | C16H28ClNO |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 1-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)butan-2-amine;hydrochloride |
| SMILES | CCOc1cc(C)c(CC(N)CC)cc1C(C)C.Cl |
| InChI | InChI=1S/C16H27NO.ClH/c1-6-14(17)9-13-10-15(11(3)4)16(18-7-2)8-12(13)5;/h8,10-11,14H,6-7,9,17H2,1-5H3;1H |
| InChIKey | BOADPWPSECTMMU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |