C19H32ClNO — CID 170889912
1-[4-tert-butyl-5-(cyclopropylmethoxy)-2-methylphenyl]butan-2-amine;hydrochloride (PubChem CID 170889912) has the molecular formula C19H32ClNO and a molecular weight of 325.92 g/mol. Its IUPAC name is 1-[4-tert-butyl-5-(cyclopropylmethoxy)-2-methylphenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[4-tert-butyl-5-(cyclopropylmethoxy)-2-methylphenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889912 |
| Molecular Formula | C19H32ClNO |
| Molecular Weight | 325.92 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-[4-tert-butyl-5-(cyclopropylmethoxy)-2-methylphenyl]butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1cc(OCC2CC2)c(C(C)(C)C)cc1C.Cl |
| InChI | InChI=1S/C19H31NO.ClH/c1-6-16(20)10-15-11-18(21-12-14-7-8-14)17(9-13(15)2)19(3,4)5;/h9,11,14,16H,6-8,10,12,20H2,1-5H3;1H |
| InChIKey | GELSGYCNUQJKCY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |