C15H24ClNO — CID 170890309
1-[4-(cyclopropylmethoxy)-2-methylphenyl]butan-2-amine;hydrochloride (PubChem CID 170890309) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethoxy)-2-methylphenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[4-(cyclopropylmethoxy)-2-methylphenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890309 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-[4-(cyclopropylmethoxy)-2-methylphenyl]butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1ccc(OCC2CC2)cc1C.Cl |
| InChI | InChI=1S/C15H23NO.ClH/c1-3-14(16)9-13-6-7-15(8-11(13)2)17-10-12-4-5-12;/h6-8,12,14H,3-5,9-10,16H2,1-2H3;1H |
| InChIKey | XORHNODYEHXICS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |