C18H30ClNO — CID 170889904
1-[5-butan-2-yl-2-(cyclopropylmethoxy)phenyl]butan-2-amine;hydrochloride (PubChem CID 170889904) has the molecular formula C18H30ClNO and a molecular weight of 311.90 g/mol. Its IUPAC name is 1-[5-butan-2-yl-2-(cyclopropylmethoxy)phenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[5-butan-2-yl-2-(cyclopropylmethoxy)phenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889904 |
| Molecular Formula | C18H30ClNO |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-[5-butan-2-yl-2-(cyclopropylmethoxy)phenyl]butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1cc(C(C)CC)ccc1OCC1CC1.Cl |
| InChI | InChI=1S/C18H29NO.ClH/c1-4-13(3)15-8-9-18(20-12-14-6-7-14)16(10-15)11-17(19)5-2;/h8-10,13-14,17H,4-7,11-12,19H2,1-3H3;1H |
| InChIKey | ZGOJMPXOPNKNCG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |