C17H28ClNO — CID 170893909
1-[5-butan-2-yl-2-(cyclopropylmethoxy)phenyl]propan-2-amine;hydrochloride (PubChem CID 170893909) has the molecular formula C17H28ClNO and a molecular weight of 297.87 g/mol. Its IUPAC name is 1-[5-butan-2-yl-2-(cyclopropylmethoxy)phenyl]propan-2-amine;hydrochloride.
| Compound Name | 1-[5-butan-2-yl-2-(cyclopropylmethoxy)phenyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170893909 |
| Molecular Formula | C17H28ClNO |
| Molecular Weight | 297.87 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-[5-butan-2-yl-2-(cyclopropylmethoxy)phenyl]propan-2-amine;hydrochloride |
| SMILES | CCC(C)c1ccc(OCC2CC2)c(CC(C)N)c1.Cl |
| InChI | InChI=1S/C17H27NO.ClH/c1-4-12(2)15-7-8-17(19-11-14-5-6-14)16(10-15)9-13(3)18;/h7-8,10,12-14H,4-6,9,11,18H2,1-3H3;1H |
| InChIKey | AWEDNAYRLQRWPM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |