C19H32ClNO2 — CID 170890274
1-[5-[2-(cyclopropylmethoxy)ethyl]-2-propoxyphenyl]butan-2-amine;hydrochloride (PubChem CID 170890274) has the molecular formula C19H32ClNO2 and a molecular weight of 341.92 g/mol. Its IUPAC name is 1-[5-[2-(cyclopropylmethoxy)ethyl]-2-propoxyphenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[5-[2-(cyclopropylmethoxy)ethyl]-2-propoxyphenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890274 |
| Molecular Formula | C19H32ClNO2 |
| Molecular Weight | 341.92 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-[5-[2-(cyclopropylmethoxy)ethyl]-2-propoxyphenyl]butan-2-amine;hydrochloride |
| SMILES | CCCOc1ccc(CCOCC2CC2)cc1CC(N)CC.Cl |
| InChI | InChI=1S/C19H31NO2.ClH/c1-3-10-22-19-8-7-15(9-11-21-14-16-5-6-16)12-17(19)13-18(20)4-2;/h7-8,12,16,18H,3-6,9-11,13-14,20H2,1-2H3;1H |
| InChIKey | DFYWLBMIEDNFBK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|