C17H28ClNO2 — CID 170890268
1-[5-[2-(cyclopropylmethoxy)ethyl]-2-methoxyphenyl]butan-2-amine;hydrochloride (PubChem CID 170890268) has the molecular formula C17H28ClNO2 and a molecular weight of 313.87 g/mol. Its IUPAC name is 1-[5-[2-(cyclopropylmethoxy)ethyl]-2-methoxyphenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[5-[2-(cyclopropylmethoxy)ethyl]-2-methoxyphenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890268 |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[5-[2-(cyclopropylmethoxy)ethyl]-2-methoxyphenyl]butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1cc(CCOCC2CC2)ccc1OC.Cl |
| InChI | InChI=1S/C17H27NO2.ClH/c1-3-16(18)11-15-10-13(6-7-17(15)19-2)8-9-20-12-14-4-5-14;/h6-7,10,14,16H,3-5,8-9,11-12,18H2,1-2H3;1H |
| InChIKey | CWQCCMNJQXZHTL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|