C12H21ClN2O2 — CID 45264254
4-(2-aminobutyl)-2,5-dimethoxyaniline;hydrochloride (PubChem CID 45264254) has the molecular formula C12H21ClN2O2 and a molecular weight of 260.76 g/mol. Its IUPAC name is 4-(2-aminobutyl)-2,5-dimethoxyaniline;hydrochloride.
| Compound Name | 4-(2-aminobutyl)-2,5-dimethoxyaniline;hydrochloride |
|---|---|
| PubChem CID | 45264254 |
| Molecular Formula | C12H21ClN2O2 |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-(2-aminobutyl)-2,5-dimethoxyaniline;hydrochloride |
| SMILES | CCC(N)Cc1cc(OC)c(N)cc1OC.Cl |
| InChI | InChI=1S/C12H20N2O2.ClH/c1-4-9(13)5-8-6-12(16-3)10(14)7-11(8)15-2;/h6-7,9H,4-5,13-14H2,1-3H3;1H |
| InChIKey | HPEUBNWLNOBWNI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|