C12H20N2O2 — CID 54283299
4-[(2R)-2-aminobutyl]-2,5-dimethoxyaniline (PubChem CID 54283299) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-[(2R)-2-aminobutyl]-2,5-dimethoxyaniline.
| Compound Name | 4-[(2R)-2-aminobutyl]-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 54283299 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 4-[(2R)-2-aminobutyl]-2,5-dimethoxyaniline |
| SMILES | CC[C@@H](N)Cc1cc(OC)c(N)cc1OC |
| InChI | InChI=1S/C12H20N2O2/c1-4-9(13)5-8-6-12(16-3)10(14)7-11(8)15-2/h6-7,9H,4-5,13-14H2,1-3H3/t9-/m1/s1 |
| InChIKey | RSHZRAACDMYHMP-SECBINFHSA-N |
| XLogP | 1.57 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|