C12H15FO3 — CID 83922764
2-[2-(2-fluoro-4,5-dimethoxyphenyl)ethyl]oxirane (PubChem CID 83922764) has the molecular formula C12H15FO3 and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-[2-(2-fluoro-4,5-dimethoxyphenyl)ethyl]oxirane.
| Compound Name | 2-[2-(2-fluoro-4,5-dimethoxyphenyl)ethyl]oxirane |
|---|---|
| PubChem CID | 83922764 |
| Molecular Formula | C12H15FO3 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[2-(2-fluoro-4,5-dimethoxyphenyl)ethyl]oxirane |
| SMILES | COc1cc(F)c(CCC2CO2)cc1OC |
| InChI | InChI=1S/C12H15FO3/c1-14-11-5-8(3-4-9-7-16-9)10(13)6-12(11)15-2/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | CEEMCQWVYZLVQS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|