C13H20FNO3 — CID 65304742
2-[2-(2-fluoro-4,5-dimethoxyphenyl)ethoxy]-N-methylethanamine (PubChem CID 65304742) has the molecular formula C13H20FNO3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-[2-(2-fluoro-4,5-dimethoxyphenyl)ethoxy]-N-methylethanamine.
| Compound Name | 2-[2-(2-fluoro-4,5-dimethoxyphenyl)ethoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 65304742 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-[2-(2-fluoro-4,5-dimethoxyphenyl)ethoxy]-N-methylethanamine |
| SMILES | CNCCOCCc1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C13H20FNO3/c1-15-5-7-18-6-4-10-8-12(16-2)13(17-3)9-11(10)14/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | SQPRKMFKNVIQMM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|