C14H23NO2 — CID 83068822
2-[2-(4-methoxy-3,5-dimethylphenyl)ethoxy]-N-methylethanamine (PubChem CID 83068822) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 2-[2-(4-methoxy-3,5-dimethylphenyl)ethoxy]-N-methylethanamine.
| Compound Name | 2-[2-(4-methoxy-3,5-dimethylphenyl)ethoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 83068822 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2-[2-(4-methoxy-3,5-dimethylphenyl)ethoxy]-N-methylethanamine |
| SMILES | CNCCOCCc1cc(C)c(OC)c(C)c1 |
| InChI | InChI=1S/C14H23NO2/c1-11-9-13(5-7-17-8-6-15-3)10-12(2)14(11)16-4/h9-10,15H,5-8H2,1-4H3 |
| InChIKey | ZGWDNLWUMGGCQT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|