C15H25NO2 — CID 115217828
4-[2-(4-methoxy-3,5-dimethylphenyl)ethylamino]butan-1-ol (PubChem CID 115217828) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-[2-(4-methoxy-3,5-dimethylphenyl)ethylamino]butan-1-ol.
| Compound Name | 4-[2-(4-methoxy-3,5-dimethylphenyl)ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 115217828 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 4-[2-(4-methoxy-3,5-dimethylphenyl)ethylamino]butan-1-ol |
| SMILES | COc1c(C)cc(CCNCCCCO)cc1C |
| InChI | InChI=1S/C15H25NO2/c1-12-10-14(11-13(2)15(12)18-3)6-8-16-7-4-5-9-17/h10-11,16-17H,4-9H2,1-3H3 |
| InChIKey | WKQZJKLADSMNEF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|