C25H40Cl2N2O2 — CID 19838089
N'-[2-(3,4-dimethoxy-5-methylphenyl)ethyl]-N-(2-phenylethyl)hexane-1,6-diamine;dihydrochloride (PubChem CID 19838089) has the molecular formula C25H40Cl2N2O2 and a molecular weight of 471.51 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxy-5-methylphenyl)ethyl]-N-(2-phenylethyl)hexane-1,6-diamine;dihydrochloride.
| Compound Name | N'-[2-(3,4-dimethoxy-5-methylphenyl)ethyl]-N-(2-phenylethyl)hexane-1,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 19838089 |
| Molecular Formula | C25H40Cl2N2O2 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | N'-[2-(3,4-dimethoxy-5-methylphenyl)ethyl]-N-(2-phenylethyl)hexane-1,6-diamine;dihydrochloride |
| SMILES | COc1cc(CCNCCCCCCNCCc2ccccc2)cc(C)c1OC.Cl.Cl |
| InChI | InChI=1S/C25H38N2O2.2ClH/c1-21-19-23(20-24(28-2)25(21)29-3)14-18-27-16-10-5-4-9-15-26-17-13-22-11-7-6-8-12-22;;/h6-8,11-12,19-20,26-27H,4-5,9-10,13-18H2,1-3H3;2*1H |
| InChIKey | GFGVVWZVEJNTKV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|