C19H25NO2 — CID 71371223
2,3-dimethoxy-5-(5-phenylpentyl)aniline (PubChem CID 71371223) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(5-phenylpentyl)aniline.
| Compound Name | 2,3-dimethoxy-5-(5-phenylpentyl)aniline |
|---|---|
| PubChem CID | 71371223 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2,3-dimethoxy-5-(5-phenylpentyl)aniline |
| SMILES | COc1cc(CCCCCc2ccccc2)cc(N)c1OC |
| InChI | InChI=1S/C19H25NO2/c1-21-18-14-16(13-17(20)19(18)22-2)12-8-4-7-11-15-9-5-3-6-10-15/h3,5-6,9-10,13-14H,4,7-8,11-12,20H2,1-2H3 |
| InChIKey | XXGORVFSGXCBMZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|