C17H21NO3 — CID 83005249
4,5-dimethoxy-2-(3-phenylpropoxy)aniline (PubChem CID 83005249) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(3-phenylpropoxy)aniline.
| Compound Name | 4,5-dimethoxy-2-(3-phenylpropoxy)aniline |
|---|---|
| PubChem CID | 83005249 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4,5-dimethoxy-2-(3-phenylpropoxy)aniline |
| SMILES | COc1cc(N)c(OCCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C17H21NO3/c1-19-16-11-14(18)15(12-17(16)20-2)21-10-6-9-13-7-4-3-5-8-13/h3-5,7-8,11-12H,6,9-10,18H2,1-2H3 |
| InChIKey | UPYUAFNDZVVUPR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|