C17H22N2O — CID 79588899
4-N,4-N-dimethyl-2-(3-phenylpropoxy)benzene-1,4-diamine (PubChem CID 79588899) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-(3-phenylpropoxy)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-2-(3-phenylpropoxy)benzene-1,4-diamine |
|---|---|
| PubChem CID | 79588899 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 4-N,4-N-dimethyl-2-(3-phenylpropoxy)benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(N)c(OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C17H22N2O/c1-19(2)15-10-11-16(18)17(13-15)20-12-6-9-14-7-4-3-5-8-14/h3-5,7-8,10-11,13H,6,9,12,18H2,1-2H3 |
| InChIKey | GNYXUHJOHHNSLE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|