C10H14F2N2O — CID 79588821
2-(2,2-difluoroethoxy)-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 79588821) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 2-(2,2-difluoroethoxy)-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 79588821 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(N)c(OCC(F)F)c1 |
| InChI | InChI=1S/C10H14F2N2O/c1-14(2)7-3-4-8(13)9(5-7)15-6-10(11)12/h3-5,10H,6,13H2,1-2H3 |
| InChIKey | JYZDGLIRLIMRNH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|